C15H25BrN2O2S — CID 107250780
tert-butyl N-[2-[1-(3-bromothiophen-2-yl)ethylamino]butyl]carbamate (PubChem CID 107250780) has the molecular formula C15H25BrN2O2S and a molecular weight of 377.35 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(3-bromothiophen-2-yl)ethylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(3-bromothiophen-2-yl)ethylamino]butyl]carbamate |
|---|---|
| PubChem CID | 107250780 |
| Molecular Formula | C15H25BrN2O2S |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | tert-butyl N-[2-[1-(3-bromothiophen-2-yl)ethylamino]butyl]carbamate |
| SMILES | CCC(CNC(=O)OC(C)(C)C)NC(C)c1sccc1Br |
| InChI | InChI=1S/C15H25BrN2O2S/c1-6-11(9-17-14(19)20-15(3,4)5)18-10(2)13-12(16)7-8-21-13/h7-8,10-11,18H,6,9H2,1-5H3,(H,17,19) |
| InChIKey | GESCXAYYHMMILG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |