C14H23BrN2O2S — CID 107247394
tert-butyl N-[1-[1-(3-bromothiophen-2-yl)ethylamino]propan-2-yl]carbamate (PubChem CID 107247394) has the molecular formula C14H23BrN2O2S and a molecular weight of 363.32 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(3-bromothiophen-2-yl)ethylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(3-bromothiophen-2-yl)ethylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 107247394 |
| Molecular Formula | C14H23BrN2O2S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | tert-butyl N-[1-[1-(3-bromothiophen-2-yl)ethylamino]propan-2-yl]carbamate |
| SMILES | CC(CNC(C)c1sccc1Br)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23BrN2O2S/c1-9(17-13(18)19-14(3,4)5)8-16-10(2)12-11(15)6-7-20-12/h6-7,9-10,16H,8H2,1-5H3,(H,17,18) |
| InChIKey | JKTUUFJCOJRAAX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |