C10H16BrNO2S — CID 60815874
N-[1-(3-bromothiophen-2-yl)ethyl]-2,2-dimethoxyethanamine (PubChem CID 60815874) has the molecular formula C10H16BrNO2S and a molecular weight of 294.21 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)ethyl]-2,2-dimethoxyethanamine.
| Compound Name | N-[1-(3-bromothiophen-2-yl)ethyl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 60815874 |
| Molecular Formula | C10H16BrNO2S |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)ethyl]-2,2-dimethoxyethanamine |
| SMILES | COC(CNC(C)c1sccc1Br)OC |
| InChI | InChI=1S/C10H16BrNO2S/c1-7(10-8(11)4-5-15-10)12-6-9(13-2)14-3/h4-5,7,9,12H,6H2,1-3H3 |
| InChIKey | DBVMBCHUTFEIIK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|