C9H11BrClNS — CID 115891113
N-[1-(3-bromothiophen-2-yl)ethyl]-2-chloroprop-2-en-1-amine (PubChem CID 115891113) has the molecular formula C9H11BrClNS and a molecular weight of 280.62 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)ethyl]-2-chloroprop-2-en-1-amine.
| Compound Name | N-[1-(3-bromothiophen-2-yl)ethyl]-2-chloroprop-2-en-1-amine |
|---|---|
| PubChem CID | 115891113 |
| Molecular Formula | C9H11BrClNS |
| Molecular Weight | 280.62 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)ethyl]-2-chloroprop-2-en-1-amine |
| SMILES | C=C(Cl)CNC(C)c1sccc1Br |
| InChI | InChI=1S/C9H11BrClNS/c1-6(11)5-12-7(2)9-8(10)3-4-13-9/h3-4,7,12H,1,5H2,2H3 |
| InChIKey | SHDWQTHIBVPWRJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |