C10H16BrNOS — CID 43771158
2-[1-(3-bromothiophen-2-yl)ethylamino]butan-1-ol (PubChem CID 43771158) has the molecular formula C10H16BrNOS and a molecular weight of 278.21 g/mol. Its IUPAC name is 2-[1-(3-bromothiophen-2-yl)ethylamino]butan-1-ol.
| Compound Name | 2-[1-(3-bromothiophen-2-yl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 43771158 |
| Molecular Formula | C10H16BrNOS |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2-[1-(3-bromothiophen-2-yl)ethylamino]butan-1-ol |
| SMILES | CCC(CO)NC(C)c1sccc1Br |
| InChI | InChI=1S/C10H16BrNOS/c1-3-8(6-13)12-7(2)10-9(11)4-5-14-10/h4-5,7-8,12-13H,3,6H2,1-2H3 |
| InChIKey | KFCNOHJCUVUGSK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |