C18H32N2O2S — CID 107245927
tert-butyl N-[2-[(2-methyl-1-thiophen-2-ylpropyl)amino]ethyl]-N-propan-2-ylcarbamate (PubChem CID 107245927) has the molecular formula C18H32N2O2S and a molecular weight of 340.53 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-methyl-1-thiophen-2-ylpropyl)amino]ethyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[2-[(2-methyl-1-thiophen-2-ylpropyl)amino]ethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 107245927 |
| Molecular Formula | C18H32N2O2S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl N-[2-[(2-methyl-1-thiophen-2-ylpropyl)amino]ethyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)C(NCCN(C(=O)OC(C)(C)C)C(C)C)c1cccs1 |
| InChI | InChI=1S/C18H32N2O2S/c1-13(2)16(15-9-8-12-23-15)19-10-11-20(14(3)4)17(21)22-18(5,6)7/h8-9,12-14,16,19H,10-11H2,1-7H3 |
| InChIKey | RCIZCJWFXFQOEZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |