C17H29N3O2 — CID 107245661
tert-butyl N-propan-2-yl-N-[2-(1-pyridin-2-ylethylamino)ethyl]carbamate (PubChem CID 107245661) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is tert-butyl N-propan-2-yl-N-[2-(1-pyridin-2-ylethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-propan-2-yl-N-[2-(1-pyridin-2-ylethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107245661 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | tert-butyl N-propan-2-yl-N-[2-(1-pyridin-2-ylethylamino)ethyl]carbamate |
| SMILES | CC(NCCN(C(=O)OC(C)(C)C)C(C)C)c1ccccn1 |
| InChI | InChI=1S/C17H29N3O2/c1-13(2)20(16(21)22-17(4,5)6)12-11-18-14(3)15-9-7-8-10-19-15/h7-10,13-14,18H,11-12H2,1-6H3 |
| InChIKey | OJUYYKJAALVZRB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |