C13H23NO6S2 — CID 91117825
2-[(2-methylpropan-2-yl)oxycarbonyl-[2-(2-sulfanylacetyl)oxyethyl]amino]ethyl 2-sulfanylacetate (PubChem CID 91117825) has the molecular formula C13H23NO6S2 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonyl-[2-(2-sulfanylacetyl)oxyethyl]amino]ethyl 2-sulfanylacetate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonyl-[2-(2-sulfanylacetyl)oxyethyl]amino]ethyl 2-sulfanylacetate |
|---|---|
| PubChem CID | 91117825 |
| Molecular Formula | C13H23NO6S2 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonyl-[2-(2-sulfanylacetyl)oxyethyl]amino]ethyl 2-sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)N(CCOC(=O)CS)CCOC(=O)CS |
| InChI | InChI=1S/C13H23NO6S2/c1-13(2,3)20-12(17)14(4-6-18-10(15)8-21)5-7-19-11(16)9-22/h21-22H,4-9H2,1-3H3 |
| InChIKey | RLBDJSSEKLREAI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 82.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|