C18H27NO2 — CID 163452966
tert-butyl N-benzyl-N-(3-ethylcyclobutyl)carbamate (PubChem CID 163452966) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-(3-ethylcyclobutyl)carbamate.
| Compound Name | tert-butyl N-benzyl-N-(3-ethylcyclobutyl)carbamate |
|---|---|
| PubChem CID | 163452966 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | tert-butyl N-benzyl-N-(3-ethylcyclobutyl)carbamate |
| SMILES | CCC1CC(N(Cc2ccccc2)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H27NO2/c1-5-14-11-16(12-14)19(17(20)21-18(2,3)4)13-15-9-7-6-8-10-15/h6-10,14,16H,5,11-13H2,1-4H3 |
| InChIKey | BIBOOHJNRZIKJN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |