C24H32N2O4S — CID 168885821
tert-butyl N-benzyl-N-[5-(benzylamino)-1,1-dioxothian-3-yl]carbamate (PubChem CID 168885821) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[5-(benzylamino)-1,1-dioxothian-3-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[5-(benzylamino)-1,1-dioxothian-3-yl]carbamate |
|---|---|
| PubChem CID | 168885821 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | tert-butyl N-benzyl-N-[5-(benzylamino)-1,1-dioxothian-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C1CC(NCc2ccccc2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C24H32N2O4S/c1-24(2,3)30-23(27)26(16-20-12-8-5-9-13-20)22-14-21(17-31(28,29)18-22)25-15-19-10-6-4-7-11-19/h4-13,21-22,25H,14-18H2,1-3H3 |
| InChIKey | FAYYFTLACZTLGW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |