C19H33N3O2 — CID 162005885
N-benzyl-2,6-dimethylpiperidin-4-amine;tert-butyl carbamate (PubChem CID 162005885) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is N-benzyl-2,6-dimethylpiperidin-4-amine;tert-butyl carbamate.
| Compound Name | N-benzyl-2,6-dimethylpiperidin-4-amine;tert-butyl carbamate |
|---|---|
| PubChem CID | 162005885 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | N-benzyl-2,6-dimethylpiperidin-4-amine;tert-butyl carbamate |
| SMILES | CC(C)(C)OC(N)=O.CC1CC(NCc2ccccc2)CC(C)N1 |
| InChI | InChI=1S/C14H22N2.C5H11NO2/c1-11-8-14(9-12(2)16-11)15-10-13-6-4-3-5-7-13;1-5(2,3)8-4(6)7/h3-7,11-12,14-16H,8-10H2,1-2H3;1-3H3,(H2,6,7) |
| InChIKey | YSVCWKJABCIZRI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |