C16H21F3N2O2 — CID 68843110
N-benzyl-8-azabicyclo[3.2.1]octan-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 68843110) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-benzyl-8-azabicyclo[3.2.1]octan-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-benzyl-8-azabicyclo[3.2.1]octan-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68843110 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-benzyl-8-azabicyclo[3.2.1]octan-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(CNC2CC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C14H20N2.C2HF3O2/c1-2-4-11(5-3-1)10-15-14-8-12-6-7-13(9-14)16-12;3-2(4,5)1(6)7/h1-5,12-16H,6-10H2;(H,6,7) |
| InChIKey | IQFJAIDZPLMAKC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |