C16H28 — CID 143924676
ethane;tricyclo[5.5.0.03,5]dodeca-1,6-diene (PubChem CID 143924676) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is ethane;tricyclo[5.5.0.03,5]dodeca-1,6-diene.
| Compound Name | ethane;tricyclo[5.5.0.03,5]dodeca-1,6-diene |
|---|---|
| PubChem CID | 143924676 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | ethane;tricyclo[5.5.0.03,5]dodeca-1,6-diene |
| SMILES | C1=C2CCCCCC2=CC2CC12.CC.CC |
| InChI | InChI=1S/C12H16.2C2H6/c1-2-4-9-6-11-8-12(11)7-10(9)5-3-1;2*1-2/h6-7,11-12H,1-5,8H2;2*1-2H3 |
| InChIKey | WNTQHMIXKKCREJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |