C23H22O4 — CID 11523380
2,5-dihydroxy-3-[2-[3-[2-(3-methylphenyl)ethyl]phenyl]ethyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 11523380) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2,5-dihydroxy-3-[2-[3-[2-(3-methylphenyl)ethyl]phenyl]ethyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3-[2-[3-[2-(3-methylphenyl)ethyl]phenyl]ethyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11523380 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2,5-dihydroxy-3-[2-[3-[2-(3-methylphenyl)ethyl]phenyl]ethyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1cccc(CCc2cccc(CCC3=C(O)C(=O)C=C(O)C3=O)c2)c1 |
| InChI | InChI=1S/C23H22O4/c1-15-4-2-5-16(12-15)8-9-17-6-3-7-18(13-17)10-11-19-22(26)20(24)14-21(25)23(19)27/h2-7,12-14,24,27H,8-11H2,1H3 |
| InChIKey | KZIRNWJDVDIAKO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|