C20H32O4 — CID 118733905
2,5-dihydroxy-3-tetradecylcyclohexa-2,5-diene-1,4-dione (PubChem CID 118733905) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 2,5-dihydroxy-3-tetradecylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3-tetradecylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118733905 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2,5-dihydroxy-3-tetradecylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCCCCCCCCC1=C(O)C(=O)C=C(O)C1=O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(23)17(21)15-18(22)20(16)24/h15,21,24H,2-14H2,1H3 |
| InChIKey | QZRBZICRAFMUAQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|