C10H12O3 — CID 22392317
2-butyl-3-hydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 22392317) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-butyl-3-hydroxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-butyl-3-hydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 22392317 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-butyl-3-hydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCC1=C(O)C(=O)C=CC1=O |
| InChI | InChI=1S/C10H12O3/c1-2-3-4-7-8(11)5-6-9(12)10(7)13/h5-6,13H,2-4H2,1H3 |
| InChIKey | OSEXMTPTBITXBA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|