C25H36O4 — CID 88503323
2-butyl-3-hydroxycyclohexa-2,5-diene-1,4-dione;2,6-ditert-butyl-4-methylphenol (PubChem CID 88503323) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-butyl-3-hydroxycyclohexa-2,5-diene-1,4-dione;2,6-ditert-butyl-4-methylphenol.
| Compound Name | 2-butyl-3-hydroxycyclohexa-2,5-diene-1,4-dione;2,6-ditert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 88503323 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-butyl-3-hydroxycyclohexa-2,5-diene-1,4-dione;2,6-ditert-butyl-4-methylphenol |
| SMILES | CCCCC1=C(O)C(=O)C=CC1=O.Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O.C10H12O3/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;1-2-3-4-7-8(11)5-6-9(12)10(7)13/h8-9,16H,1-7H3;5-6,13H,2-4H2,1H3 |
| InChIKey | NNFWSIGGVWMUQL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|