C14H20O2 — CID 18356690
2,3-dibutylcyclohexa-2,5-diene-1,4-dione (PubChem CID 18356690) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,3-dibutylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dibutylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 18356690 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,3-dibutylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCC1=C(CCCC)C(=O)C=CC1=O |
| InChI | InChI=1S/C14H20O2/c1-3-5-7-11-12(8-6-4-2)14(16)10-9-13(11)15/h9-10H,3-8H2,1-2H3 |
| InChIKey | ARFBHYZYGWUOGK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|