About 2,3-dibutylcyclohexa-2,5-diene-1,4-dione
2,3-dibutylcyclohexa-2,5-diene-1,4-dione (PubChem CID 18356690) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,3-dibutylcyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | 2,3-dibutylcyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 18356690 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,3-dibutylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCC1=C(CCCC)C(=O)C=CC1=O |
| InChI | InChI=1S/C14H20O2/c1-3-5-7-11-12(8-6-4-2)14(16)10-9-13(11)15/h9-10H,3-8H2,1-2H3 |
| InChIKey | ARFBHYZYGWUOGK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibutylcyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibutylcyclohexa-2,5-diene-1,4-dione?
The IUPAC name of 2,3-dibutylcyclohexa-2,5-diene-1,4-dione (CID 18356690) is 2,3-dibutylcyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for 2,3-dibutylcyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for 2,3-dibutylcyclohexa-2,5-diene-1,4-dione is CCCCC1=C(CCCC)C(=O)C=CC1=O.
What is the InChIKey of 2,3-dibutylcyclohexa-2,5-diene-1,4-dione?
The InChIKey is ARFBHYZYGWUOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-3-5-7-11-12(8-6-4-2)14(16)10-9-13(11)15/h9-10H,3-8H2,1-2H3.
What are the key properties of 2,3-dibutylcyclohexa-2,5-diene-1,4-dione?
2,3-dibutylcyclohexa-2,5-diene-1,4-dione has a molecular weight of 220.31 g/mol, XLogP of 3.37, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibutylcyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 18356690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).