C19H32O — CID 86058900
2,3-dibutyl-4,5-dipropylcyclopenta-2,4-dien-1-one (PubChem CID 86058900) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 2,3-dibutyl-4,5-dipropylcyclopenta-2,4-dien-1-one.
| Compound Name | 2,3-dibutyl-4,5-dipropylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 86058900 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 2,3-dibutyl-4,5-dipropylcyclopenta-2,4-dien-1-one |
| SMILES | CCCCC1=C(CCCC)C(CCC)=C(CCC)C1=O |
| InChI | InChI=1S/C19H32O/c1-5-9-13-16-15(11-7-3)17(12-8-4)19(20)18(16)14-10-6-2/h5-14H2,1-4H3 |
| InChIKey | UNNSNSSHDUELFK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |