C27H52OSi2 — CID 101003600
3,4-dioctyl-2,5-bis(trimethylsilyl)cyclopenta-2,4-dien-1-one (PubChem CID 101003600) has the molecular formula C27H52OSi2 and a molecular weight of 448.88 g/mol. Its IUPAC name is 3,4-dioctyl-2,5-bis(trimethylsilyl)cyclopenta-2,4-dien-1-one.
| Compound Name | 3,4-dioctyl-2,5-bis(trimethylsilyl)cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 101003600 |
| Molecular Formula | C27H52OSi2 |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 3,4-dioctyl-2,5-bis(trimethylsilyl)cyclopenta-2,4-dien-1-one |
| SMILES | CCCCCCCCC1=C([Si](C)(C)C)C(=O)C([Si](C)(C)C)=C1CCCCCCCC |
| InChI | InChI=1S/C27H52OSi2/c1-9-11-13-15-17-19-21-23-24(22-20-18-16-14-12-10-2)27(30(6,7)8)25(28)26(23)29(3,4)5/h9-22H2,1-8H3 |
| InChIKey | PWYCJBLYKVBNGP-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|