C18H26N2O2 — CID 141389615
1,4-dihexylpyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 141389615) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1,4-dihexylpyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-dihexylpyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 141389615 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1,4-dihexylpyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCc1nc(=O)c2c(CCCCCC)nc(=O)c1=2 |
| InChI | InChI=1S/C18H26N2O2/c1-3-5-7-9-11-13-15-16(18(22)19-13)14(20-17(15)21)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | YBNAHBJXIUXKQS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|