C14H18Br2O2 — CID 15632229
2,5-dibromo-3-heptyl-6-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 15632229) has the molecular formula C14H18Br2O2 and a molecular weight of 378.10 g/mol. Its IUPAC name is 2,5-dibromo-3-heptyl-6-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dibromo-3-heptyl-6-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15632229 |
| Molecular Formula | C14H18Br2O2 |
| Molecular Weight | 378.10 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2,5-dibromo-3-heptyl-6-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCC1=C(Br)C(=O)C(C)=C(Br)C1=O |
| InChI | InChI=1S/C14H18Br2O2/c1-3-4-5-6-7-8-10-12(16)13(17)9(2)11(15)14(10)18/h3-8H2,1-2H3 |
| InChIKey | ZBDYKJFYQSSZPI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.10 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|