C20H31ClO2 — CID 14066044
3-chloro-2-methyl-5-tridecylcyclohexa-2,5-diene-1,4-dione (PubChem CID 14066044) has the molecular formula C20H31ClO2 and a molecular weight of 338.92 g/mol. Its IUPAC name is 3-chloro-2-methyl-5-tridecylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-chloro-2-methyl-5-tridecylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 14066044 |
| Molecular Formula | C20H31ClO2 |
| Molecular Weight | 338.92 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-chloro-2-methyl-5-tridecylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCCCCCCCC1=CC(=O)C(C)=C(Cl)C1=O |
| InChI | InChI=1S/C20H31ClO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-15-18(22)16(2)19(21)20(17)23/h15H,3-14H2,1-2H3 |
| InChIKey | ZDQFHGYFFCJLBY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|