C15H22O4 — CID 15294744
2-hexyl-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 15294744) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-hexyl-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-hexyl-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15294744 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-hexyl-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCC1=C(C)C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C15H22O4/c1-5-6-7-8-9-11-10(2)12(16)14(18-3)15(19-4)13(11)17/h5-9H2,1-4H3 |
| InChIKey | ZOCHBOVCJPRXOT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|