C26H41NO6 — CID 167227129
2,3-dimethoxy-5-methyl-6-[(E)-8-nitroheptadec-8-enyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 167227129) has the molecular formula C26H41NO6 and a molecular weight of 463.62 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(E)-8-nitroheptadec-8-enyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(E)-8-nitroheptadec-8-enyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 167227129 |
| Molecular Formula | C26H41NO6 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(E)-8-nitroheptadec-8-enyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCC/C=C(\CCCCCCCC1=C(C)C(=O)C(OC)=C(OC)C1=O)[N+](=O)[O-] |
| InChI | InChI=1S/C26H41NO6/c1-5-6-7-8-9-11-14-17-21(27(30)31)18-15-12-10-13-16-19-22-20(2)23(28)25(32-3)26(33-4)24(22)29/h17H,5-16,18-19H2,1-4H3/b21-17+ |
| InChIKey | MSWQWERCXHDPJU-HEHNFIMWSA-N |
| XLogP | 6.60 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|