About 10-nitrohexadec-9-enoic acid
10-nitrohexadec-9-enoic acid (PubChem CID 74955183) has the molecular formula C16H29NO4
and a molecular weight of 299.41 g/mol. Its IUPAC name is 10-nitrohexadec-9-enoic acid.
Molecular Properties
| Compound Name | 10-nitrohexadec-9-enoic acid |
| PubChem CID | 74955183 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 10-nitrohexadec-9-enoic acid |
| SMILES | CCCCCCC(=CCCCCCCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C16H29NO4/c1-2-3-4-9-12-15(17(20)21)13-10-7-5-6-8-11-14-16(18)19/h13H,2-12,14H2,1H3,(H,18,19) |
| InChIKey | WZWPBDQYCAJWSX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-nitrohexadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-nitrohexadec-9-enoic acid?
The IUPAC name of 10-nitrohexadec-9-enoic acid (CID 74955183) is 10-nitrohexadec-9-enoic acid.
What is the SMILES notation for 10-nitrohexadec-9-enoic acid?
The canonical SMILES for 10-nitrohexadec-9-enoic acid is CCCCCCC(=CCCCCCCCC(=O)O)[N+](=O)[O-].
What is the InChIKey of 10-nitrohexadec-9-enoic acid?
The InChIKey is WZWPBDQYCAJWSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO4/c1-2-3-4-9-12-15(17(20)21)13-10-7-5-6-8-11-14-16(18)19/h13H,2-12,14H2,1H3,(H,18,19).
What are the key properties of 10-nitrohexadec-9-enoic acid?
10-nitrohexadec-9-enoic acid has a molecular weight of 299.41 g/mol, XLogP of 4.93, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-nitrohexadec-9-enoic acid is sourced from PubChem (CID 74955183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).