About 6-nitroundec-5-ene
6-nitroundec-5-ene (PubChem CID 543366) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 6-nitroundec-5-ene.
Molecular Properties
| Compound Name | 6-nitroundec-5-ene |
| PubChem CID | 543366 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 6-nitroundec-5-ene |
| SMILES | CCCCC=C(CCCCC)[N+](=O)[O-] |
| InChI | InChI=1S/C11H21NO2/c1-3-5-7-9-11(12(13)14)10-8-6-4-2/h9H,3-8,10H2,1-2H3 |
| InChIKey | UOOQMRALLOBXAB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitroundec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitroundec-5-ene?
The IUPAC name of 6-nitroundec-5-ene (CID 543366) is 6-nitroundec-5-ene.
What is the SMILES notation for 6-nitroundec-5-ene?
The canonical SMILES for 6-nitroundec-5-ene is CCCCC=C(CCCCC)[N+](=O)[O-].
What is the InChIKey of 6-nitroundec-5-ene?
The InChIKey is UOOQMRALLOBXAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-3-5-7-9-11(12(13)14)10-8-6-4-2/h9H,3-8,10H2,1-2H3.
What are the key properties of 6-nitroundec-5-ene?
6-nitroundec-5-ene has a molecular weight of 199.29 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitroundec-5-ene is sourced from PubChem (CID 543366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).