About (E)-7-nitrodec-7-en-1-ol
(E)-7-nitrodec-7-en-1-ol (PubChem CID 6433081) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is (E)-7-nitrodec-7-en-1-ol.
Molecular Properties
| Compound Name | (E)-7-nitrodec-7-en-1-ol |
| PubChem CID | 6433081 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (E)-7-nitrodec-7-en-1-ol |
| SMILES | CC/C=C(\CCCCCCO)[N+](=O)[O-] |
| InChI | InChI=1S/C10H19NO3/c1-2-7-10(11(13)14)8-5-3-4-6-9-12/h7,12H,2-6,8-9H2,1H3/b10-7+ |
| InChIKey | UWNFUXZRPSLANA-JXMROGBWSA-N |
| XLogP | 2.50 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-nitrodec-7-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-nitrodec-7-en-1-ol?
The IUPAC name of (E)-7-nitrodec-7-en-1-ol (CID 6433081) is (E)-7-nitrodec-7-en-1-ol.
What is the SMILES notation for (E)-7-nitrodec-7-en-1-ol?
The canonical SMILES for (E)-7-nitrodec-7-en-1-ol is CC/C=C(\CCCCCCO)[N+](=O)[O-].
What is the InChIKey of (E)-7-nitrodec-7-en-1-ol?
The InChIKey is UWNFUXZRPSLANA-JXMROGBWSA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-7-10(11(13)14)8-5-3-4-6-9-12/h7,12H,2-6,8-9H2,1H3/b10-7+.
What are the key properties of (E)-7-nitrodec-7-en-1-ol?
(E)-7-nitrodec-7-en-1-ol has a molecular weight of 201.27 g/mol, XLogP of 2.50, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-nitrodec-7-en-1-ol is sourced from PubChem (CID 6433081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).