About 8-nitropentadec-8-enoic acid
8-nitropentadec-8-enoic acid (PubChem CID 123226831) has the molecular formula C15H27NO4
and a molecular weight of 285.38 g/mol. Its IUPAC name is 8-nitropentadec-8-enoic acid.
Molecular Properties
| Compound Name | 8-nitropentadec-8-enoic acid |
| PubChem CID | 123226831 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 8-nitropentadec-8-enoic acid |
| SMILES | CCCCCCC=C(CCCCCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C15H27NO4/c1-2-3-4-5-8-11-14(16(19)20)12-9-6-7-10-13-15(17)18/h11H,2-10,12-13H2,1H3,(H,17,18) |
| InChIKey | CNIYAWIVPAPZGX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitropentadec-8-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitropentadec-8-enoic acid?
The IUPAC name of 8-nitropentadec-8-enoic acid (CID 123226831) is 8-nitropentadec-8-enoic acid.
What is the SMILES notation for 8-nitropentadec-8-enoic acid?
The canonical SMILES for 8-nitropentadec-8-enoic acid is CCCCCCC=C(CCCCCCC(=O)O)[N+](=O)[O-].
What is the InChIKey of 8-nitropentadec-8-enoic acid?
The InChIKey is CNIYAWIVPAPZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO4/c1-2-3-4-5-8-11-14(16(19)20)12-9-6-7-10-13-15(17)18/h11H,2-10,12-13H2,1H3,(H,17,18).
What are the key properties of 8-nitropentadec-8-enoic acid?
8-nitropentadec-8-enoic acid has a molecular weight of 285.38 g/mol, XLogP of 4.54, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitropentadec-8-enoic acid is sourced from PubChem (CID 123226831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).