C18H30N2O5 — CID 173492327
(9E,12E)-10,13-dinitrooctadeca-9,12-dienal (PubChem CID 173492327) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is (9E,12E)-10,13-dinitrooctadeca-9,12-dienal.
| Compound Name | (9E,12E)-10,13-dinitrooctadeca-9,12-dienal |
|---|---|
| PubChem CID | 173492327 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (9E,12E)-10,13-dinitrooctadeca-9,12-dienal |
| SMILES | CCCCC/C(=C\C/C(=C\CCCCCCCC=O)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C18H30N2O5/c1-2-3-9-12-17(19(22)23)14-15-18(20(24)25)13-10-7-5-4-6-8-11-16-21/h13-14,16H,2-12,15H2,1H3/b17-14+,18-13+ |
| InChIKey | MICBGKZCJIGOBD-IHOZNAONSA-N |
| XLogP | 5.21 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|