C22H33NO3 — CID 173492145
(4Z,7Z,10Z,13Z,16E)-16-nitrodocosa-4,7,10,13,16-pentaenal (PubChem CID 173492145) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16E)-16-nitrodocosa-4,7,10,13,16-pentaenal.
| Compound Name | (4Z,7Z,10Z,13Z,16E)-16-nitrodocosa-4,7,10,13,16-pentaenal |
|---|---|
| PubChem CID | 173492145 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16E)-16-nitrodocosa-4,7,10,13,16-pentaenal |
| SMILES | CCCCC/C=C(\C/C=C\C/C=C\C/C=C\C/C=C\CCC=O)[N+](=O)[O-] |
| InChI | InChI=1S/C22H33NO3/c1-2-3-4-16-19-22(23(25)26)20-17-14-12-10-8-6-5-7-9-11-13-15-18-21-24/h5,7-8,10-11,13-14,17,19,21H,2-4,6,9,12,15-16,18,20H2,1H3/b7-5-,10-8-,13-11-,17-14-,22-19+ |
| InChIKey | KAVIWMKIKVVJTP-MBGIBBHJSA-N |
| XLogP | 6.49 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|