C18H28N2O5 — CID 173492247
(6E,9Z,12Z)-10,13-dinitrooctadeca-6,9,12-trienal (PubChem CID 173492247) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is (6E,9Z,12Z)-10,13-dinitrooctadeca-6,9,12-trienal.
| Compound Name | (6E,9Z,12Z)-10,13-dinitrooctadeca-6,9,12-trienal |
|---|---|
| PubChem CID | 173492247 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (6E,9Z,12Z)-10,13-dinitrooctadeca-6,9,12-trienal |
| SMILES | CCCCC/C(=C/C/C(=C/C/C=C/CCCCC=O)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C18H28N2O5/c1-2-3-9-12-17(19(22)23)14-15-18(20(24)25)13-10-7-5-4-6-8-11-16-21/h5,7,13-14,16H,2-4,6,8-12,15H2,1H3/b7-5+,17-14-,18-13- |
| InChIKey | ILJFGLSVCHGOQU-GMGVJQPZSA-N |
| XLogP | 4.98 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|