C20H33NO4 — CID 173492389
(5Z,8Z,14Z)-15-hydroxy-14-nitroicosa-5,8,14-trienal (PubChem CID 173492389) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is (5Z,8Z,14Z)-15-hydroxy-14-nitroicosa-5,8,14-trienal.
| Compound Name | (5Z,8Z,14Z)-15-hydroxy-14-nitroicosa-5,8,14-trienal |
|---|---|
| PubChem CID | 173492389 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | (5Z,8Z,14Z)-15-hydroxy-14-nitroicosa-5,8,14-trienal |
| SMILES | CCCCC/C(O)=C(\CCCC/C=C\C/C=C\CCCC=O)[N+](=O)[O-] |
| InChI | InChI=1S/C20H33NO4/c1-2-3-13-17-20(23)19(21(24)25)16-14-11-9-7-5-4-6-8-10-12-15-18-22/h5-8,18,23H,2-4,9-17H2,1H3/b7-5-,8-6-,20-19- |
| InChIKey | UAUQFJZZLOXTLB-XYWZEEPDSA-N |
| XLogP | 6.05 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|