About (Z)-10-nitroicos-9-enal
(Z)-10-nitroicos-9-enal (PubChem CID 89267084) has the molecular formula C20H37NO3
and a molecular weight of 339.52 g/mol. Its IUPAC name is (Z)-10-nitroicos-9-enal.
Molecular Properties
| Compound Name | (Z)-10-nitroicos-9-enal |
| PubChem CID | 89267084 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | (Z)-10-nitroicos-9-enal |
| SMILES | CCCCCCCCCC/C(=C/CCCCCCCC=O)[N+](=O)[O-] |
| InChI | InChI=1S/C20H37NO3/c1-2-3-4-5-6-8-11-14-17-20(21(23)24)18-15-12-9-7-10-13-16-19-22/h18-19H,2-17H2,1H3/b20-18- |
| InChIKey | LGQYOVMPTMIPMT-ZZEZOPTASA-N |
| XLogP | 6.61 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-10-nitroicos-9-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-10-nitroicos-9-enal?
The IUPAC name of (Z)-10-nitroicos-9-enal (CID 89267084) is (Z)-10-nitroicos-9-enal.
What is the SMILES notation for (Z)-10-nitroicos-9-enal?
The canonical SMILES for (Z)-10-nitroicos-9-enal is CCCCCCCCCC/C(=C/CCCCCCCC=O)[N+](=O)[O-].
What is the InChIKey of (Z)-10-nitroicos-9-enal?
The InChIKey is LGQYOVMPTMIPMT-ZZEZOPTASA-N. The full InChI is InChI=1S/C20H37NO3/c1-2-3-4-5-6-8-11-14-17-20(21(23)24)18-15-12-9-7-10-13-16-19-22/h18-19H,2-17H2,1H3/b20-18-.
What are the key properties of (Z)-10-nitroicos-9-enal?
(Z)-10-nitroicos-9-enal has a molecular weight of 339.52 g/mol, XLogP of 6.61, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-10-nitroicos-9-enal is sourced from PubChem (CID 89267084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).