C21H34N2O6S — CID 87276088
3-[(9Z,12E,15Z)-9,15-dinitrooctadeca-9,12,15-trienyl]sulfanylpropanoic acid (PubChem CID 87276088) has the molecular formula C21H34N2O6S and a molecular weight of 442.58 g/mol. Its IUPAC name is 3-[(9Z,12E,15Z)-9,15-dinitrooctadeca-9,12,15-trienyl]sulfanylpropanoic acid.
| Compound Name | 3-[(9Z,12E,15Z)-9,15-dinitrooctadeca-9,12,15-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87276088 |
| Molecular Formula | C21H34N2O6S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 3-[(9Z,12E,15Z)-9,15-dinitrooctadeca-9,12,15-trienyl]sulfanylpropanoic acid |
| SMILES | CC/C=C(/C/C=C/C/C=C(/CCCCCCCCSCCC(=O)O)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C21H34N2O6S/c1-2-12-19(22(26)27)13-9-7-10-15-20(23(28)29)14-8-5-3-4-6-11-17-30-18-16-21(24)25/h7,9,12,15H,2-6,8,10-11,13-14,16-18H2,1H3,(H,24,25)/b9-7+,19-12-,20-15- |
| InChIKey | DITLVHWLKZWCSN-XNBMETETSA-N |
| XLogP | 5.99 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|