C23H37NO4S — CID 123388068
3-(7-nitroicosa-5,7,11,14-tetraenylsulfanyl)propanoic acid (PubChem CID 123388068) has the molecular formula C23H37NO4S and a molecular weight of 423.62 g/mol. Its IUPAC name is 3-(7-nitroicosa-5,7,11,14-tetraenylsulfanyl)propanoic acid.
| Compound Name | 3-(7-nitroicosa-5,7,11,14-tetraenylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 123388068 |
| Molecular Formula | C23H37NO4S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 3-(7-nitroicosa-5,7,11,14-tetraenylsulfanyl)propanoic acid |
| SMILES | CCCCCC=CCC=CCCC=C(C=CCCCCSCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C23H37NO4S/c1-2-3-4-5-6-7-8-9-10-11-14-17-22(24(27)28)18-15-12-13-16-20-29-21-19-23(25)26/h6-7,9-10,15,17-18H,2-5,8,11-14,16,19-21H2,1H3,(H,25,26) |
| InChIKey | YRMSBZOQURBSJU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|