C12H19NO3S — CID 75951689
9-nitrododeca-6,9-dienethioic S-acid (PubChem CID 75951689) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 9-nitrododeca-6,9-dienethioic S-acid.
| Compound Name | 9-nitrododeca-6,9-dienethioic S-acid |
|---|---|
| PubChem CID | 75951689 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 9-nitrododeca-6,9-dienethioic S-acid |
| SMILES | CCC=C(CC=CCCCCC(=O)S)[N+](=O)[O-] |
| InChI | InChI=1S/C12H19NO3S/c1-2-8-11(13(15)16)9-6-4-3-5-7-10-12(14)17/h4,6,8H,2-3,5,7,9-10H2,1H3,(H,14,17) |
| InChIKey | QBAPRZIDENNGCR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|