(9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid

C18H29NO4 — CID 90092242

IUPAC(9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid
SMILESCC/C=C(\C/C=C\C/C=C\CCCCCCCC(=O)O)[N+](=O)[O-]
InChIInChI=1S/C18H29NO4/c1-2-14-17(19(22)23)15-12-10-8-6-4-3-5-7-9-11-13-16-18(20)21/h4,6,10,12,14H,2-3,5,7-9,11,13,15-16H2,1H3,(H,20,21)/b6-4-,12-10-,17-14+
InChIKeyRRCUDWCPORMMDJ-XDHUAGTDSA-N
MW323.43 g/mol
LogP5.26
Rot. Bonds14

About (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid

(9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid (PubChem CID 90092242) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid.

Molecular Properties

Compound Name(9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid
PubChem CID90092242
Molecular FormulaC18H29NO4
Molecular Weight323.43 g/mol
Exact Mass323.21
IUPAC Name(9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid
SMILESCC/C=C(\C/C=C\C/C=C\CCCCCCCC(=O)O)[N+](=O)[O-]
InChIInChI=1S/C18H29NO4/c1-2-14-17(19(22)23)15-12-10-8-6-4-3-5-7-9-11-13-16-18(20)21/h4,6,10,12,14H,2-3,5,7-9,11,13,15-16H2,1H3,(H,20,21)/b6-4-,12-10-,17-14+
InChIKeyRRCUDWCPORMMDJ-XDHUAGTDSA-N
XLogP5.26
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds14
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500323.43
LogP ≤ 55.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid?
The IUPAC name of (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid (CID 90092242) is (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid.
What is the SMILES notation for (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid?
The canonical SMILES for (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid is CC/C=C(\C/C=C\C/C=C\CCCCCCCC(=O)O)[N+](=O)[O-].
What is the InChIKey of (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid?
The InChIKey is RRCUDWCPORMMDJ-XDHUAGTDSA-N. The full InChI is InChI=1S/C18H29NO4/c1-2-14-17(19(22)23)15-12-10-8-6-4-3-5-7-9-11-13-16-18(20)21/h4,6,10,12,14H,2-3,5,7-9,11,13,15-16H2,1H3,(H,20,21)/b6-4-,12-10-,17-14+.
What are the key properties of (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid?
(9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid has a molecular weight of 323.43 g/mol, XLogP of 5.26, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid is sourced from PubChem (CID 90092242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).