C18H29NO4 — CID 90092242
(9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid (PubChem CID 90092242) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid.
| Compound Name | (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid |
|---|---|
| PubChem CID | 90092242 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (9Z,12Z,15E)-15-nitrooctadeca-9,12,15-trienoic acid |
| SMILES | CC/C=C(\C/C=C\C/C=C\CCCCCCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C18H29NO4/c1-2-14-17(19(22)23)15-12-10-8-6-4-3-5-7-9-11-13-16-18(20)21/h4,6,10,12,14H,2-3,5,7-9,11,13,15-16H2,1H3,(H,20,21)/b6-4-,12-10-,17-14+ |
| InChIKey | RRCUDWCPORMMDJ-XDHUAGTDSA-N |
| XLogP | 5.26 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|