C21H32O6 — CID 11090205
10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl acetate (PubChem CID 11090205) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl acetate.
| Compound Name | 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl acetate |
|---|---|
| PubChem CID | 11090205 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl acetate |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCOC(C)=O)=C(C)C1=O |
| InChI | InChI=1S/C21H32O6/c1-15-17(19(24)21(26-4)20(25-3)18(15)23)13-11-9-7-5-6-8-10-12-14-27-16(2)22/h5-14H2,1-4H3 |
| InChIKey | SAAXJJSVGGARNN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|