C43H68O12 — CID 161199791
tert-butyl 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl carbonate;2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 161199791) has the molecular formula C43H68O12 and a molecular weight of 777.00 g/mol. Its IUPAC name is tert-butyl 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl carbonate;2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | tert-butyl 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl carbonate;2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 161199791 |
| Molecular Formula | C43H68O12 |
| Molecular Weight | 777.00 g/mol |
| Exact Mass | 776.47 |
| IUPAC Name | tert-butyl 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl carbonate;2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCO)=C(C)C1=O.COC1=C(OC)C(=O)C(CCCCCCCCCCOC(=O)OC(C)(C)C)=C(C)C1=O |
| InChI | InChI=1S/C24H38O7.C19H30O5/c1-17-18(20(26)22(29-6)21(28-5)19(17)25)15-13-11-9-7-8-10-12-14-16-30-23(27)31-24(2,3)4;1-14-15(12-10-8-6-4-5-7-9-11-13-20)17(22)19(24-3)18(23-2)16(14)21/h7-16H2,1-6H3;20H,4-13H2,1-3H3 |
| InChIKey | UUVCEOCPVGNVRQ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.00 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|