C23H28O6 — CID 14822010
[4-[6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]phenyl] acetate (PubChem CID 14822010) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is [4-[6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]phenyl] acetate.
| Compound Name | [4-[6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]phenyl] acetate |
|---|---|
| PubChem CID | 14822010 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [4-[6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]phenyl] acetate |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCc2ccc(OC(C)=O)cc2)=C(C)C1=O |
| InChI | InChI=1S/C23H28O6/c1-15-19(21(26)23(28-4)22(27-3)20(15)25)10-8-6-5-7-9-17-11-13-18(14-12-17)29-16(2)24/h11-14H,5-10H2,1-4H3 |
| InChIKey | PYZHBTDFKDPFMW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|