C25H33ClO5 — CID 66764734
2-[10-(4-chlorophenoxy)decyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 66764734) has the molecular formula C25H33ClO5 and a molecular weight of 448.99 g/mol. Its IUPAC name is 2-[10-(4-chlorophenoxy)decyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[10-(4-chlorophenoxy)decyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 66764734 |
| Molecular Formula | C25H33ClO5 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[10-(4-chlorophenoxy)decyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCOc2ccc(Cl)cc2)=C(C)C1=O |
| InChI | InChI=1S/C25H33ClO5/c1-18-21(23(28)25(30-3)24(29-2)22(18)27)12-10-8-6-4-5-7-9-11-17-31-20-15-13-19(26)14-16-20/h13-16H,4-12,17H2,1-3H3 |
| InChIKey | GKGPTIMHRHODLO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|