C24H26Cl2NO2+ — CID 71604556
2,6-bis[3-(4-chlorophenoxy)propyl]-1-methylpyridin-1-ium (PubChem CID 71604556) has the molecular formula C24H26Cl2NO2+ and a molecular weight of 431.38 g/mol. Its IUPAC name is 2,6-bis[3-(4-chlorophenoxy)propyl]-1-methylpyridin-1-ium.
| Compound Name | 2,6-bis[3-(4-chlorophenoxy)propyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 71604556 |
| Molecular Formula | C24H26Cl2NO2+ |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2,6-bis[3-(4-chlorophenoxy)propyl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1c(CCCOc2ccc(Cl)cc2)cccc1CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26Cl2NO2/c1-27-21(7-3-17-28-23-13-9-19(25)10-14-23)5-2-6-22(27)8-4-18-29-24-15-11-20(26)12-16-24/h2,5-6,9-16H,3-4,7-8,17-18H2,1H3/q+1 |
| InChIKey | KVXDNUSQIINBHQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|