C40H62NO11+ — CID 90097577
bis[11-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)undecan-2-yloxy]-oxoazanium (PubChem CID 90097577) has the molecular formula C40H62NO11+ and a molecular weight of 732.93 g/mol. Its IUPAC name is bis[11-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)undecan-2-yloxy]-oxoazanium.
| Compound Name | bis[11-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)undecan-2-yloxy]-oxoazanium |
|---|---|
| PubChem CID | 90097577 |
| Molecular Formula | C40H62NO11+ |
| Molecular Weight | 732.93 g/mol |
| Exact Mass | 732.43 |
| IUPAC Name | bis[11-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)undecan-2-yloxy]-oxoazanium |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCC(C)O[N+](=O)OC(C)CCCCCCCCCC2=C(C)C(=O)C(OC)=C(OC)C2=O)=C(C)C1=O |
| InChI | InChI=1S/C40H62NO11/c1-27(23-19-15-11-9-13-17-21-25-31-29(3)33(42)37(47-5)39(49-7)35(31)44)51-41(46)52-28(2)24-20-16-12-10-14-18-22-26-32-30(4)34(43)38(48-6)40(50-8)36(32)45/h27-28H,9-26H2,1-8H3/q+1 |
| InChIKey | KSNHCDHRLMCDST-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 143.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.93 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|