C21H24O6 — CID 13385982
12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)dodeca-2,7-diynoic acid (PubChem CID 13385982) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)dodeca-2,7-diynoic acid.
| Compound Name | 12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)dodeca-2,7-diynoic acid |
|---|---|
| PubChem CID | 13385982 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)dodeca-2,7-diynoic acid |
| SMILES | COC1=C(OC)C(=O)C(CCCCC#CCCCC#CC(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C21H24O6/c1-15-16(19(25)21(27-3)20(26-2)18(15)24)13-11-9-7-5-4-6-8-10-12-14-17(22)23/h6-11,13H2,1-3H3,(H,22,23) |
| InChIKey | FSBBBDDVKCERKL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|