C31H30O4 — CID 143006766
2,3-dimethoxy-5-methyl-6-(4,4,4-triphenylbutyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 143006766) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-(4,4,4-triphenylbutyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-(4,4,4-triphenylbutyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 143006766 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-(4,4,4-triphenylbutyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCC(c2ccccc2)(c2ccccc2)c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C31H30O4/c1-22-26(28(33)30(35-3)29(34-2)27(22)32)20-13-21-31(23-14-7-4-8-15-23,24-16-9-5-10-17-24)25-18-11-6-12-19-25/h4-12,14-19H,13,20-21H2,1-3H3 |
| InChIKey | OFVQDGVZPSQYCJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|