C11H18O4 — CID 10375944
2-butyl-3,4,4-trimethoxycyclobut-2-en-1-one (PubChem CID 10375944) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-butyl-3,4,4-trimethoxycyclobut-2-en-1-one.
| Compound Name | 2-butyl-3,4,4-trimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10375944 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-butyl-3,4,4-trimethoxycyclobut-2-en-1-one |
| SMILES | CCCCC1=C(OC)C(OC)(OC)C1=O |
| InChI | InChI=1S/C11H18O4/c1-5-6-7-8-9(12)11(14-3,15-4)10(8)13-2/h5-7H2,1-4H3 |
| InChIKey | VAFLGKXJAJSUCJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|