C19H28O5 — CID 4984594
(4-hydroxy-3,6-dioxo-5-undecylcyclohexa-1,4-dien-1-yl) acetate (PubChem CID 4984594) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (4-hydroxy-3,6-dioxo-5-undecylcyclohexa-1,4-dien-1-yl) acetate.
| Compound Name | (4-hydroxy-3,6-dioxo-5-undecylcyclohexa-1,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 4984594 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (4-hydroxy-3,6-dioxo-5-undecylcyclohexa-1,4-dien-1-yl) acetate |
| SMILES | CCCCCCCCCCCC1=C(O)C(=O)C=C(OC(C)=O)C1=O |
| InChI | InChI=1S/C19H28O5/c1-3-4-5-6-7-8-9-10-11-12-15-18(22)16(21)13-17(19(15)23)24-14(2)20/h13,22H,3-12H2,1-2H3 |
| InChIKey | WVPYXPCOBXYDAL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|