C9H10O4 — CID 66800320
2-hydroxy-3-(2-methoxyethyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 66800320) has the molecular formula C9H10O4 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-hydroxy-3-(2-methoxyethyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-hydroxy-3-(2-methoxyethyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 66800320 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-hydroxy-3-(2-methoxyethyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COCCC1=C(O)C(=O)C=CC1=O |
| InChI | InChI=1S/C9H10O4/c1-13-5-4-6-7(10)2-3-8(11)9(6)12/h2-3,12H,4-5H2,1H3 |
| InChIKey | GTLUAMJFOYZFSX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|