C16H20O4 — CID 118733907
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 118733907) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118733907 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC1=C(O)C(=O)C=C(O)C1=O |
| InChI | InChI=1S/C16H20O4/c1-10(2)5-4-6-11(3)7-8-12-15(19)13(17)9-14(18)16(12)20/h5,7,9,17,20H,4,6,8H2,1-3H3/b11-7+ |
| InChIKey | WLGCIQYXKPKVKY-YRNVUSSQSA-N |
| XLogP | 3.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|